cas: 1451392-31-6 — see every product listed under this CAS number, including other names
3-(N,O-Dimethylhydroxylaminocarbonyl)-5-fluorophenylboronic acid (CAS 1451392-31-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627940-1G |
| cas | 1451392-31-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3564.39 Pln |
| delivery time | 3-4 weeks |
|---|
[3-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 1451392-31-6) is a chemical compound with the molecular formula C9H11BFNO4 and a molecular weight of 227.00 g/mol. IUPAC name: [3-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: KQSBAHYEQPZQMF-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO4 |
|---|---|
| Molecular weight | 227.00 g/mol |
| IUPAC name | [3-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | KQSBAHYEQPZQMF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)N(C)OC)(O)O |
Computed by PubChem (NCBI)