CAS 874289-21-1 appears in our catalog under these names: N-(2-Hydroxyethyl) 4-borono-2-fluorobenzamide, 96%, (3-Fluoro-4-((2-hydroxyethyl)carbamoyl)phenyl)boronic acid 96%, (3-Fluoro-4-((2-hydroxyethyl)carbamoyl)phenyl)boronic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
[3-fluoro-4-(2-hydroxyethylcarbamoyl)phenyl]boronic acid (CAS 874289-21-1) is a chemical compound with the molecular formula C9H11BFNO4 and a molecular weight of 227.00 g/mol. IUPAC name: [3-fluoro-4-(2-hydroxyethylcarbamoyl)phenyl]boronic acid. InChIKey: RNKVHZGEFMLELU-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO4 |
|---|---|
| Molecular weight | 227.00 g/mol |
| IUPAC name | [3-fluoro-4-(2-hydroxyethylcarbamoyl)phenyl]boronic acid |
| InChIKey | RNKVHZGEFMLELU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NCCO)F)(O)O |
Computed by PubChem (NCBI)