CAS 874289-59-5 appears in our catalog under these names: N-Methoxy-N-methyl 3-borono-4-fluorobenzamide, 98%, N-Methoxy-N-methyl 3-borono-4-fluorobenzamide 98%, 2-Fluoro-5-(methoxy(methyl)carbamoyl)phenylboronic acid, 98%, 98%, (2-Fluoro-5-(methoxy(methyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[2-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 874289-59-5) is a chemical compound with the molecular formula C9H11BFNO4 and a molecular weight of 227.00 g/mol. IUPAC name: [2-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: UIALQZJYMDELNI-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO4 |
|---|---|
| Molecular weight | 227.00 g/mol |
| IUPAC name | [2-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | UIALQZJYMDELNI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N(C)OC)F)(O)O |
Computed by PubChem (NCBI)