CAS 913835-59-3 appears in our catalog under these names: N-Methoxy-N-methyl 4-borono-2-fluorobenzamide, 98%, (3-Fluoro-4-(methoxy(methyl)carbamoyl)phenyl)boronic acid 98%, (3-Fluoro-4-(methoxy(methyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
[3-fluoro-4-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 913835-59-3) is a chemical compound with the molecular formula C9H11BFNO4 and a molecular weight of 227.00 g/mol. IUPAC name: [3-fluoro-4-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: QPQWMXDTOWMILI-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO4 |
|---|---|
| Molecular weight | 227.00 g/mol |
| IUPAC name | [3-fluoro-4-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | QPQWMXDTOWMILI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N(C)OC)F)(O)O |
Computed by PubChem (NCBI)