CAS 521982-80-9 appears in our catalog under these names: 3-(Oxazol-4-yl)aniline, 95%, 3-(Oxazol-4-yl)aniline, 95%, 95%, 3-(Oxazol-4-yl)aniline, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 5g.
3-(1,3-oxazol-4-yl)aniline (CAS 521982-80-9) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 3-(1,3-oxazol-4-yl)aniline. InChIKey: ZHOOTBMJVAOIIO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 3-(1,3-oxazol-4-yl)aniline |
| InChIKey | ZHOOTBMJVAOIIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=COC=N2 |
Computed by PubChem (NCBI)