3-(Phenylethynyl)oxazolidin-2-one, 98%
cas: 888329-88-2 — see every product listed under this CAS number, including other names
3-(Phenylethynyl)oxazolidin-2-one, 98% (CAS 888329-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1414173-250mg |
| cas | 888329-88-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Ambeed | 5g | 5537.94 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1375.10 Pln | |
| BLDpharm | 5g | 5962.37 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 1143.37 Pln | |
| Fluorochem | 1g | 2705.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-(2-phenylethynyl)-1,3-oxazolidin-2-one (CAS 888329-88-2) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 3-(2-phenylethynyl)-1,3-oxazolidin-2-one. InChIKey: GBUSLWYYBBBMGC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 3-(2-phenylethynyl)-1,3-oxazolidin-2-one |
| InChIKey | GBUSLWYYBBBMGC-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C#CC2=CC=CC=C2 |
Computed by PubChem (NCBI)