cas: 726185-55-3 — see every product listed under this CAS number, including other names
3-(Piperidin-4-yl)benzoic acid hydrochloride, 98+% (CAS 726185-55-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A732575-5g |
| cas | 726185-55-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6755.77 Pln | |
| AmBeed | 10g | 12425.98 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-piperidin-4-ylbenzoic acid;hydrochloride (CAS 726185-55-3) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 3-piperidin-4-ylbenzoic acid;hydrochloride. InChIKey: WISJNYKHUINTKI-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 3-piperidin-4-ylbenzoic acid;hydrochloride |
| InChIKey | WISJNYKHUINTKI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)