cas: 208190-04-9 — see every product listed under this CAS number, including other names
3-(Pyridin-4-yl)benzaldehyde 95% (CAS 208190-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A686640-250mg |
| cas | 208190-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 25g | 1816.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A686640 |
3-pyridin-4-ylbenzaldehyde (CAS 208190-04-9) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 3-pyridin-4-ylbenzaldehyde. InChIKey: ANVUAAJNQXEBNM-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 3-pyridin-4-ylbenzaldehyde |
| InChIKey | ANVUAAJNQXEBNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=NC=C2)C=O |
Computed by PubChem (NCBI)