CAS 885273-05-2 appears in our catalog under these names: 6-(Furan-3-yl)-1h-indole, 95%, 6-(Furan-3-yl)-1H-indole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
6-(furan-3-yl)-1H-indole (CAS 885273-05-2) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 6-(furan-3-yl)-1H-indole. InChIKey: SESUSXJVWJHEOW-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 6-(furan-3-yl)-1H-indole |
| InChIKey | SESUSXJVWJHEOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2)C3=COC=C3 |
Computed by PubChem (NCBI)