Products 85-15-4
CAS 85-15-4 appears in our catalog under these names: 2-Methylnaphth[1,2-d]oxazole, 95%, 2-Methylnaphtho[1,2-d]oxazole, 98%, 2-Methylnaphth(1,2-d)oxazole, >95% (HPLC), 2–Methylnaphth(1，2–d)oxazole, 2-Methylnaphth[1,2-d]oxazole, >98.0%(GC). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TCI. Available pack sizes: 25g, 5g, 1g, on request, 100mg, 500mg, 10g, 250mg.
2-methylbenzo[e][1,3]benzoxazole (CAS 85-15-4) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 2-methylbenzo[e][1,3]benzoxazole. InChIKey: JCTNVNANPZAULC-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 2-methylbenzo[e][1,3]benzoxazole |
| InChIKey | JCTNVNANPZAULC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)
Synonyms:
2-Methylnaphth[1,2-d]oxazole, 2-Methylnaphtho[1,2-d]oxazole, Naphth[1,2-d]oxazole, 2-methyl-, 2-Methylnaphth(1,2-d)oxazole, Naphth(1,2-d)oxazole, 2-methyl-, 2-Methylnaphtho(1,2-d)oxazole, 2-methylbenzo[e][1,3]benzoxazole, 2-methylnaphtho[1,2-d][1,3]oxazole, 2-methylnaphthoxazole, 2-methyl-naphth[1,2-d]oxazole