CAS 90381-43-4 appears in our catalog under these names: 7-Methoxy-2-naphthonitrile, 95%, 7–Methoxy–2–naphthonitrile, 7-Methoxynaphthalene-2-carbonitrile. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg.
7-methoxynaphthalene-2-carbonitrile (CAS 90381-43-4) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 7-methoxynaphthalene-2-carbonitrile. InChIKey: JYNOVHIIZNWROY-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 7-methoxynaphthalene-2-carbonitrile |
| InChIKey | JYNOVHIIZNWROY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=C2)C#N)C=C1 |
Computed by PubChem (NCBI)