CAS 878433-08-0 is the registry number for 3-(Thiophen-2-ylmethoxy)benzaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-(thiophen-2-ylmethoxy)benzaldehyde (CAS 878433-08-0) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: 3-(thiophen-2-ylmethoxy)benzaldehyde. InChIKey: WPEZXXPEJWPGLZ-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 3-(thiophen-2-ylmethoxy)benzaldehyde |
| InChIKey | WPEZXXPEJWPGLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=CC=CS2)C=O |
Computed by PubChem (NCBI)