Products 252561-11-8

CAS 252561-11-8 is the registry number for 2-[4-(Thiophen-2-yl)phenyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-thiophen-2-ylphenyl)acetic acid (CAS 252561-11-8) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: 2-(4-thiophen-2-ylphenyl)acetic acid. InChIKey: VEHXUZFCBGMKGF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O2S
Molecular weight218.27 g/mol
IUPAC name2-(4-thiophen-2-ylphenyl)acetic acid
InChIKeyVEHXUZFCBGMKGF-UHFFFAOYSA-N
SMILESC1=CSC(=C1)C2=CC=C(C=C2)CC(=O)O

Computed by PubChem (NCBI)