Products 93-21-0
CAS 93-21-0 is the registry number for (2-Naphthylthio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-naphthalen-2-ylsulfanylacetic acid (CAS 93-21-0) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: 2-naphthalen-2-ylsulfanylacetic acid. InChIKey: VMZMOCBDKZHRGU-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 2-naphthalen-2-ylsulfanylacetic acid |
| InChIKey | VMZMOCBDKZHRGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)SCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Naphthylthio)acetic acid, Brown G Acid, 2-Naphthylthioglycolic acid, Thioglycolic acid, 2-naphthyl-, beta-Naphthylthioglycolic acid, Acetic acid, 2-(2-naphthalenylthio)-, Acetic acid, (2-naphthylthio)-, Naphthalene-beta-thioglycolic acid, Acetic acid, (2-naphthylthio)-(8CI), 2-(naphthalen-2-ylsulfanyl)acetic acid