Products 2244512-87-4
CAS 2244512-87-4 appears in our catalog under these names: S-(4-Hydroxy-2-naphthyl) thioacetate, 95%, S-(4-Hydroxynaphthalen-2-yl) ethanethioate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
S-(4-hydroxynaphthalen-2-yl) ethanethioate (CAS 2244512-87-4) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: S-(4-hydroxynaphthalen-2-yl) ethanethioate. InChIKey: HVUPWBNYJSWKJL-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | S-(4-hydroxynaphthalen-2-yl) ethanethioate |
| InChIKey | HVUPWBNYJSWKJL-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1=CC2=CC=CC=C2C(=C1)O |
Computed by PubChem (NCBI)