cas: 108307-56-8 — see every product listed under this CAS number, including other names
3-(Trifluoromethoxy)phenylacetonitrile, 97% (CAS 108307-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007565-1G |
| cas | 108307-56-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 653.95 Pln | |
| Fluorochem | 100g | 2330.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-[3-(trifluoromethoxy)phenyl]acetonitrile (CAS 108307-56-8) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 2-[3-(trifluoromethoxy)phenyl]acetonitrile. InChIKey: WZLPHJZVNJXHPV-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 2-[3-(trifluoromethoxy)phenyl]acetonitrile |
| InChIKey | WZLPHJZVNJXHPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CC#N |
Computed by PubChem (NCBI)