cas: 486460-21-3 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine 98% (CAS 486460-21-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A169971-1g |
| cas | 486460-21-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1360.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A169971 |
3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (CAS 486460-21-3) is a chemical compound with the molecular formula C6H7F3N4 and a molecular weight of 192.14 g/mol. IUPAC name: 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine. InChIKey: FMTDZGCPYKWMPT-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N4 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| InChIKey | FMTDZGCPYKWMPT-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1 |
Computed by PubChem (NCBI)