CAS 777-44-6 appears in our catalog under these names: 3–(Trifluoromethyl)benzenesulfonyl Chloride, 3-(Trifluoromethyl)benzenesulfonyl chloride/ 98%, 3-(Trifluoromethyl)benzenesulfonyl Chloride, >98.0%(GC)(T), 3-(Trifluoromethyl)benzenesulfonyl chloride, 95%, 3-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%, 98%. Offered by: GLPBio, Chemat, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100g, 25g, 10g, 2g, 5g, 1g.
3-(trifluoromethyl)benzenesulfonyl chloride (CAS 777-44-6) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ONCAZCNPWWQQMW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | ONCAZCNPWWQQMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)