3-(Trifluoromethyl)phenyl acetate, 95+%
cas: 78950-34-2 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)phenyl acetate, 95+% (CAS 78950-34-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: AmBeed, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A255031-25g |
| cas | 78950-34-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 4132.24 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 548.38 Pln | |
| Ambeed | 10g | 987.81 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 842.00 Pln | |
| Chemat | 10g | 1312.40 Pln | |
| BLDpharm | 1g | 253.27 Pln | |
| BLDpharm | 5g | 580.93 Pln | |
| BLDpharm | 10g | 1058.54 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(trifluoromethyl)phenyl] acetate (CAS 78950-34-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl] acetate. InChIKey: CBAIJJMMUDSHOD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl] acetate |
| InChIKey | CBAIJJMMUDSHOD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)