cas: 2063-92-5 — see every product listed under this CAS number, including other names
3-(benzyloxy)-2,2-dimethylcyclobutan-1-one, 97% (CAS 2063-92-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A646340-10g |
| cas | 2063-92-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 23173.99 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 500mg | 841.39 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 3606.04 Pln | |
| Fluorochem | 10g | 6224.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-3-phenylmethoxycyclobutan-1-one (CAS 2063-92-5) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 2,2-dimethyl-3-phenylmethoxycyclobutan-1-one. InChIKey: OQYCKJLAKYHLTP-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 2,2-dimethyl-3-phenylmethoxycyclobutan-1-one |
| InChIKey | OQYCKJLAKYHLTP-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)