CAS 6450-57-3 appears in our catalog under these names: 1-(2-Mesitylene)-1,3-butanedione, 95%, 1-Mesitylbutane-1,3-dione, 98%, 1-(2-Mesitylene)-1,3-butanedione, >96.0%(GC), 1-(2-Mesitylene)-1,3-butanedione, 98%, 98%. Offered by: Combi-blocks, AmBeed, TCI, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 250mg.
1-(2,4,6-trimethylphenyl)butane-1,3-dione (CAS 6450-57-3) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)butane-1,3-dione. InChIKey: MBZZDUHWYNESIY-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)butane-1,3-dione |
| InChIKey | MBZZDUHWYNESIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)CC(=O)C)C |
Computed by PubChem (NCBI)