cas: 380429-42-5 — see every product listed under this CAS number, including other names
3-(tert-Butyl) 4-methyl (2S,4R)-2-(tert-butyl)oxazolidine-3,4-dicarboxylate, 98% (CAS 380429-42-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619526-250MG |
| cas | 380429-42-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 560.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-O-tert-butyl 4-O-methyl (2S,4R)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 380429-42-5) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (2S,4R)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: GZAZHWGEIRAXKK-KOLCDFICSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl (2S,4R)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | GZAZHWGEIRAXKK-KOLCDFICSA-N |
| SMILES | CC(C)(C)[C@H]1N([C@H](CO1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)