cas: 957062-71-4 — see every product listed under this CAS number, including other names
3-(trans-4-Hydroxycyclohexylcarbamoyl)phenylboronic acid, ≥96%, ≥96% (CAS 957062-71-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJDN-50mg |
| cas | 957062-71-4 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 218.00 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1394.00 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
[3-[(4-hydroxycyclohexyl)carbamoyl]phenyl]boronic acid (CAS 957062-71-4) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: [3-[(4-hydroxycyclohexyl)carbamoyl]phenyl]boronic acid. InChIKey: WBAACPSTIIWUDJ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | [3-[(4-hydroxycyclohexyl)carbamoyl]phenyl]boronic acid |
| InChIKey | WBAACPSTIIWUDJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2CCC(CC2)O)(O)O |
Computed by PubChem (NCBI)