CAS 1009094-73-8 is the registry number for 3-amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1009094-73-8) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: FCBHIFVGVWWHIM-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | FCBHIFVGVWWHIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)N)C(=O)O |
Computed by PubChem (NCBI)