CAS 957062-70-3 appears in our catalog under these names: 4-(trans-4-Hydroxycyclohexylcarbamoyl)phenylboronic acid, 98%, 4-(trans-4-Hydroxycyclohexylcarbamoyl)phenylboronic acid. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
[4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]boronic acid (CAS 957062-70-3) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: [4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]boronic acid. InChIKey: YSXTWFABWWVVAX-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | [4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]boronic acid |
| InChIKey | YSXTWFABWWVVAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CCC(CC2)O)(O)O |
Computed by PubChem (NCBI)