CAS 910235-64-2 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(2-methyl-3-nitrophenyl)-1,3,2-dioxaborolane 98%, 4,4,5,5-Tetramethyl-2-(2-methyl-3-nitrophenyl)-1,3,2-dioxaborolane, 98%, 2–METHYL–3–NITROPHENYLBORONIC ACID, PINACOL ESTER, 2-Methyl-3-nitrophenylboronic acid, pinacol ester, 98%, 2-Methyl-3-nitrophenylboronic acid, pinacol ester, 98%, 98%. Offered by: Ambeed, Fluorochem, GLPBio, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4,4,5,5-tetramethyl-2-(2-methyl-3-nitrophenyl)-1,3,2-dioxaborolane (CAS 910235-64-2) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-3-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: DGUVYVUSWYNPNM-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-3-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | DGUVYVUSWYNPNM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)