cas: 1287777-05-2 — see every product listed under this CAS number, including other names
3-[(2-Tetrahydropyranyl)oxy]phenylboronic Acid, 95%, 95% (CAS 1287777-05-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YDG-250mg |
| cas | 1287777-05-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1106.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-(oxan-2-yloxy)phenyl]boronic acid (CAS 1287777-05-2) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [3-(oxan-2-yloxy)phenyl]boronic acid. InChIKey: GPYBHNZRMWCEAW-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [3-(oxan-2-yloxy)phenyl]boronic acid |
| InChIKey | GPYBHNZRMWCEAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC2CCCCO2)(O)O |
Computed by PubChem (NCBI)