cas: 118412-66-1 — see every product listed under this CAS number, including other names
3-[(4-Fluorophenyl)carbonyl]piperidine hydrochloride, 97% (CAS 118412-66-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637099-1G |
| cas | 118412-66-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1028.82 Pln | |
| Fluorochem | 5g | 3012.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-fluorophenyl)-piperidin-3-ylmethanone;hydrochloride (CAS 118412-66-1) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: (4-fluorophenyl)-piperidin-3-ylmethanone;hydrochloride. InChIKey: ZJPKSFYBPAPDKL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | (4-fluorophenyl)-piperidin-3-ylmethanone;hydrochloride |
| InChIKey | ZJPKSFYBPAPDKL-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)