CAS 1779129-96-2 appears in our catalog under these names: 4-Fluoro-3h-spiro[2-benzofuran-1,4'-piperidine] hydrochloride, 95%, 4-Fluoro-3H-spiro(isobenzofuran-1,4'-piperidine) hydrochloride, 97%, 4–Fluoro–3H–spiro(2–benzofuran–1,4'–piperidine) hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
7-fluorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride (CAS 1779129-96-2) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: 7-fluorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: TWZGDGLDKJEJJV-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | 7-fluorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | TWZGDGLDKJEJJV-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(CO2)C(=CC=C3)F.Cl |
Computed by PubChem (NCBI)