CAS 852212-51-2 is the registry number for 3-[(3-Fluorophenyl)carbonyl]piperidine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
(3-fluorophenyl)-piperidin-3-ylmethanone;hydrochloride (CAS 852212-51-2) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: (3-fluorophenyl)-piperidin-3-ylmethanone;hydrochloride. InChIKey: DJVAKQWUBRQTJY-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | (3-fluorophenyl)-piperidin-3-ylmethanone;hydrochloride |
| InChIKey | DJVAKQWUBRQTJY-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)