CAS 64671-29-0 appears in our catalog under these names: 4-(2-Fluorobenzoyl)piperidine hydrochloride, 98%, Iloperidone Impurity 23 HCl, (2-Fluorophenyl)-4-piperidinyl-methanone Hydrochloride, 4-(2-Fluorobenzoyl)piperidine hydrochloride, 97%, 4-(2-FLUOROBENZOYL)PIPERIDINE HCL, 97%. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, on request, 50mg, 500mg.
(2-fluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 64671-29-0) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: (2-fluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: NOCFQMBSDJUUBB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | (2-fluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | NOCFQMBSDJUUBB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC=CC=C2F.Cl |
Computed by PubChem (NCBI)