cas: 913835-82-2 — see every product listed under this CAS number, including other names
3-[2-(Ethoxycarbonyl)ethyl]benzeneboronic acid 98% (CAS 913835-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123701-100mg |
| cas | 913835-82-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2189.31 Pln | |
| Ambeed | 10g | 4052.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A123701 |
[3-(3-ethoxy-3-oxopropyl)phenyl]boronic acid (CAS 913835-82-2) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [3-(3-ethoxy-3-oxopropyl)phenyl]boronic acid. InChIKey: RTJGTDXOUMFFRS-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [3-(3-ethoxy-3-oxopropyl)phenyl]boronic acid |
| InChIKey | RTJGTDXOUMFFRS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CCC(=O)OCC)(O)O |
Computed by PubChem (NCBI)