CAS 175204-40-7 appears in our catalog under these names: 3-[4-(tert-Butyl)phenyl]-5-(chloromethyl)-1,2,4-oxadiazole, Tech. , 3-(4-tert-Butylphenyl)-5-chloromethyl-[1,2,4]oxadiazole, 95%. Offered by: Thermo Scientific, Fluorochem. Available pack sizes: 1g, 10g.
3-(4-tert-butylphenyl)-5-(chloromethyl)-1,2,4-oxadiazole (CAS 175204-40-7) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-5-(chloromethyl)-1,2,4-oxadiazole. InChIKey: ZLQQUIHBQATFOP-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)-5-(chloromethyl)-1,2,4-oxadiazole |
| InChIKey | ZLQQUIHBQATFOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)