cas: 313273-62-0 — see every product listed under this CAS number, including other names
3-Acetyl-4-phenyl-1H-quinolin-2-one, 95%, 95% (CAS 313273-62-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12APZC-50mg |
| cas | 313273-62-0 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 477.20 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-acetyl-4-phenyl-1H-quinolin-2-one (CAS 313273-62-0) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 3-acetyl-4-phenyl-1H-quinolin-2-one. InChIKey: UVIFCFBKDKJCFD-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 3-acetyl-4-phenyl-1H-quinolin-2-one |
| InChIKey | UVIFCFBKDKJCFD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C2=CC=CC=C2NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)