CAS 20389-04-2 appears in our catalog under these names: 2-(3-Methylphenyl)quinoline-4-carboxylic acid, 95%, 2-(m-Tolyl)quinoline-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(3-methylphenyl)quinoline-4-carboxylic acid (CAS 20389-04-2) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 2-(3-methylphenyl)quinoline-4-carboxylic acid. InChIKey: IDICWBXZRWNVIU-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-(3-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | IDICWBXZRWNVIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)