CAS 20389-05-3 appears in our catalog under these names: 2-p-Tolyl-quinoline-4-carboxylic acid, 95%, 2-(p-Tolyl)quinoline-4-carboxylic acid. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 50mg, 200mg.
2-(4-methylphenyl)quinoline-4-carboxylic acid (CAS 20389-05-3) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 2-(4-methylphenyl)quinoline-4-carboxylic acid. InChIKey: CKOMAFAOCHXEQX-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-(4-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | CKOMAFAOCHXEQX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)