Products 43071-45-0

CAS 43071-45-0 is the registry number for 3-Methyl-2-phenylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-methyl-2-phenylquinoline-4-carboxylic acid (CAS 43071-45-0) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 3-methyl-2-phenylquinoline-4-carboxylic acid. InChIKey: ZSVACLAZDFXWQG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO2
Molecular weight263.29 g/mol
IUPAC name3-methyl-2-phenylquinoline-4-carboxylic acid
InChIKeyZSVACLAZDFXWQG-UHFFFAOYSA-N
SMILESCC1=C(C2=CC=CC=C2N=C1C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)