cas: 1630906-83-0 — see every product listed under this CAS number, including other names
3-Allylazetidine 2,2,2-trifluoroacetate, 97%, 97% (CAS 1630906-83-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TR2-250mg |
| cas | 1630906-83-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 500mg | 899.60 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4240.40 Pln | |
| Chemat | 10g | 6558.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid (CAS 1630906-83-0) is a chemical compound with the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. IUPAC name: 3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid. InChIKey: VQWLDBPVYSBGKF-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO2 |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | VQWLDBPVYSBGKF-UHFFFAOYSA-N |
| SMILES | C=CCC1CNC1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)