Products 1630906-83-0
CAS 1630906-83-0 appears in our catalog under these names: 3-(Prop-2-en-1-yl)azetidine trifluoroacetic acid, 95%, 3-Allylazetidine 2,2,2-trifluoroacetate, 97%, 3-Allylazetidine 2,2,2-trifluoroacetate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 500mg.
3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid (CAS 1630906-83-0) is a chemical compound with the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. IUPAC name: 3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid. InChIKey: VQWLDBPVYSBGKF-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO2 |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | VQWLDBPVYSBGKF-UHFFFAOYSA-N |
| SMILES | C=CCC1CNC1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
3-Allylazetidine 2,2,2-trifluoroacetate, 3-(prop-2-en-1-yl)azetidine; trifluoroacetic acid, 3-(Prop-2-en-1-yl)azetidine trifluoroacetate, 3-prop-2-enylazetidine;2,2,2-trifluoroacetic acid, 3-(Prop-2-en-1-yl)azetidine trifluoroacetic acid salt, 3-allylazetidine TFA, 3-Allylazetidine Trifluoroacetate, 3-Allylazetidine2,2,2-trifluoroacetate, 3-allylazetidine;2,2,2-trifluoroacetic acid, 3-(Prop-2-en-1-yl)azetidine trifluoroacetic acid