CAS 2766053-03-4 is the registry number for Rel-(3R,4S)-1-methyl-3-(trifluoromethyl)piperidine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-1-methyl-3-(trifluoromethyl)piperidine-4-carboxylic acid (CAS 2766053-03-4) is a chemical compound with the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. IUPAC name: (3S,4R)-1-methyl-3-(trifluoromethyl)piperidine-4-carboxylic acid. InChIKey: WAXVXRVYPWZIIG-PHDIDXHHSA-N.
| Molecular formula | C8H12F3NO2 |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | (3S,4R)-1-methyl-3-(trifluoromethyl)piperidine-4-carboxylic acid |
| InChIKey | WAXVXRVYPWZIIG-PHDIDXHHSA-N |
| SMILES | CN1CC[C@H]([C@@H](C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)