CAS 2007924-96-9 is the registry number for rel-Methyl (3R,5S)-5-(trifluoromethyl)piperidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S,5R)-5-(trifluoromethyl)piperidine-3-carboxylate (CAS 2007924-96-9) is a chemical compound with the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. IUPAC name: methyl (3S,5R)-5-(trifluoromethyl)piperidine-3-carboxylate. InChIKey: ZFYKDGRNKLVWMO-NTSWFWBYSA-N.
| Molecular formula | C8H12F3NO2 |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | methyl (3S,5R)-5-(trifluoromethyl)piperidine-3-carboxylate |
| InChIKey | ZFYKDGRNKLVWMO-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](CNC1)C(F)(F)F |
Computed by PubChem (NCBI)