cas: 91247-38-0 — see every product listed under this CAS number, including other names
3-Amino-5-phenylpentanoic Acid, ≥95%, ≥95% (CAS 91247-38-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSKT-100mg |
| cas | 91247-38-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2061.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-amino-5-phenylpentanoic acid (CAS 91247-38-0) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 3-amino-5-phenylpentanoic acid. InChIKey: CJJYCYZKUNRKFP-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 3-amino-5-phenylpentanoic acid |
| InChIKey | CJJYCYZKUNRKFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(CC(=O)O)N |
Computed by PubChem (NCBI)