CAS 147228-37-3 appears in our catalog under these names: (R)-3-Amino-5-phenylpentanoic acid, 97%, (R)-Homobenzyl-beta-alanine, 97%, (R)-Homobenzyl-beta-alanine, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3R)-3-amino-5-phenylpentanoic acid (CAS 147228-37-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (3R)-3-amino-5-phenylpentanoic acid. InChIKey: CJJYCYZKUNRKFP-SNVBAGLBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (3R)-3-amino-5-phenylpentanoic acid |
| InChIKey | CJJYCYZKUNRKFP-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)