cas: 73834-77-2 — see every product listed under this CAS number, including other names
3-Amino-9H-pyrido[3,4-b]indole, >98.0%(HPLC)(T) (CAS 73834-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2486-100MG |
| cas | 73834-77-2 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 826.43 Pln | |
| TCI | 1g | 5084.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
9H-pyrido[3,4-b]indol-3-amine (CAS 73834-77-2) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 9H-pyrido[3,4-b]indol-3-amine. InChIKey: UGMPOJSWOINMDE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indol-3-amine |
| InChIKey | UGMPOJSWOINMDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC=C3N2)N |
Computed by PubChem (NCBI)