cas: 73834-77-2 — see every product listed under this CAS number, including other names
9H-Pyrido(3,4-b)indol-3-amine, 98% (CAS 73834-77-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A554530-1g |
| cas | 73834-77-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 23766.40 Pln | |
| AmBeed | 250mg | 7686.70 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
9H-pyrido[3,4-b]indol-3-amine (CAS 73834-77-2) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 9H-pyrido[3,4-b]indol-3-amine. InChIKey: UGMPOJSWOINMDE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indol-3-amine |
| InChIKey | UGMPOJSWOINMDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC=C3N2)N |
Computed by PubChem (NCBI)