cas: 73834-77-2 — see every product listed under this CAS number, including other names
9H-Pyrido[3,4-b]indol-3-amine, ≥97%, ≥97% (CAS 73834-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IX6-100mg |
| cas | 73834-77-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 500mg | 2267.60 Pln | |
| Chemat | 1g | 3866.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
9H-pyrido[3,4-b]indol-3-amine (CAS 73834-77-2) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 9H-pyrido[3,4-b]indol-3-amine. InChIKey: UGMPOJSWOINMDE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indol-3-amine |
| InChIKey | UGMPOJSWOINMDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC=C3N2)N |
Computed by PubChem (NCBI)