cas: 6274-18-6 — see every product listed under this CAS number, including other names
3-Amino-N,N-dimethylbenzenesulfonamide 97% (CAS 6274-18-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182335-250mg |
| cas | 6274-18-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 570.62 Pln | |
| Ambeed | 10g | 804.25 Pln | |
| Ambeed | 25g | 1805.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182335 |
3-amino-N,N-dimethylbenzenesulfonamide (CAS 6274-18-6) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 3-amino-N,N-dimethylbenzenesulfonamide. InChIKey: APIVVDFBBPFBDZ-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 3-amino-N,N-dimethylbenzenesulfonamide |
| InChIKey | APIVVDFBBPFBDZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)