CAS 251552-20-2 is the registry number for N-(4-Aminophenyl)-N-methylmethanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N-(4-aminophenyl)-N-methylmethanesulfonamide (CAS 251552-20-2) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: N-(4-aminophenyl)-N-methylmethanesulfonamide. InChIKey: MGZAFDOASDXMRY-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | N-(4-aminophenyl)-N-methylmethanesulfonamide |
| InChIKey | MGZAFDOASDXMRY-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)N)S(=O)(=O)C |
Computed by PubChem (NCBI)