CAS 725222-33-3 is the registry number for 3,4-Dimethylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3,4-dimethylbenzenesulfonohydrazide (CAS 725222-33-3) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 3,4-dimethylbenzenesulfonohydrazide. InChIKey: WHBKZOLNHMKVPD-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 3,4-dimethylbenzenesulfonohydrazide |
| InChIKey | WHBKZOLNHMKVPD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NN)C |
Computed by PubChem (NCBI)