cas: 6274-18-6 — see every product listed under this CAS number, including other names
3-Amino-N,N-dimethylbenzenesulfonamide, 98% (CAS 6274-18-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 500mg, 2.5g, 100g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OT-0134-10g |
| cas | 6274-18-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 190.58 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 2.5g | 419.66 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 1008.00 Pln | |
| Fluorochem | 25g | 1794.18 Pln | |
| Fluorochem | 100g | 7026.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-amino-N,N-dimethylbenzenesulfonamide (CAS 6274-18-6) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 3-amino-N,N-dimethylbenzenesulfonamide. InChIKey: APIVVDFBBPFBDZ-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 3-amino-N,N-dimethylbenzenesulfonamide |
| InChIKey | APIVVDFBBPFBDZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)